C18H24N2O6S2 — CID 2362502
1-N,2-N-bis[(3S)-3-methyl-1,1-dioxothiolan-3-yl]benzene-1,2-dicarboxamide (PubChem CID 2362502) has the molecular formula C18H24N2O6S2 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-N,2-N-bis[(3S)-3-methyl-1,1-dioxothiolan-3-yl]benzene-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis[(3S)-3-methyl-1,1-dioxothiolan-3-yl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 2362502 |
| Molecular Formula | C18H24N2O6S2 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 1-N,2-N-bis[(3S)-3-methyl-1,1-dioxothiolan-3-yl]benzene-1,2-dicarboxamide |
| SMILES | C[C@]1(NC(=O)c2ccccc2C(=O)N[C@@]2(C)CCS(=O)(=O)C2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H24N2O6S2/c1-17(7-9-27(23,24)11-17)19-15(21)13-5-3-4-6-14(13)16(22)20-18(2)8-10-28(25,26)12-18/h3-6H,7-12H2,1-2H3,(H,19,21)(H,20,22)/t17-,18-/m0/s1 |
| InChIKey | PPUWQJRALLNPKB-ROUUACIJSA-N |
| XLogP | 0.30 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |