C15H15NO5S — CID 30414199
N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-oxochromene-3-carboxamide (PubChem CID 30414199) has the molecular formula C15H15NO5S and a molecular weight of 321.35 g/mol. Its IUPAC name is N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 30414199 |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-oxochromene-3-carboxamide |
| SMILES | C[C@]1(NC(=O)c2cc3ccccc3oc2=O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H15NO5S/c1-15(6-7-22(19,20)9-15)16-13(17)11-8-10-4-2-3-5-12(10)21-14(11)18/h2-5,8H,6-7,9H2,1H3,(H,16,17)/t15-/m0/s1 |
| InChIKey | VPCYODLNKPERPF-HNNXBMFYSA-N |
| XLogP | 1.10 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|