C11H12Br2N2O3S — CID 140870093
2,6-dibromo-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-4-carboxamide (PubChem CID 140870093) has the molecular formula C11H12Br2N2O3S and a molecular weight of 412.10 g/mol. Its IUPAC name is 2,6-dibromo-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-4-carboxamide.
| Compound Name | 2,6-dibromo-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 140870093 |
| Molecular Formula | C11H12Br2N2O3S |
| Molecular Weight | 412.10 g/mol |
| Exact Mass | 409.89 |
| IUPAC Name | 2,6-dibromo-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-4-carboxamide |
| SMILES | CC1(NC(=O)c2cc(Br)nc(Br)c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H12Br2N2O3S/c1-11(2-3-19(17,18)6-11)15-10(16)7-4-8(12)14-9(13)5-7/h4-5H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | NUTPMVQEEJLIRV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.10 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|