C13H17NO4S — CID 103951728
4-hydroxy-3-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide (PubChem CID 103951728) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 4-hydroxy-3-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 4-hydroxy-3-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 103951728 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-hydroxy-3-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide |
| SMILES | Cc1cc(C(=O)NC2(C)CCS(=O)(=O)C2)ccc1O |
| InChI | InChI=1S/C13H17NO4S/c1-9-7-10(3-4-11(9)15)12(16)14-13(2)5-6-19(17,18)8-13/h3-4,7,15H,5-6,8H2,1-2H3,(H,14,16) |
| InChIKey | DTIYVZQEPULQSX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |