C13H16N2O4S — CID 43057320
3-N-(3-methyl-1,1-dioxothiolan-3-yl)benzene-1,3-dicarboxamide (PubChem CID 43057320) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 3-N-(3-methyl-1,1-dioxothiolan-3-yl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-(3-methyl-1,1-dioxothiolan-3-yl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 43057320 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-N-(3-methyl-1,1-dioxothiolan-3-yl)benzene-1,3-dicarboxamide |
| SMILES | CC1(NC(=O)c2cccc(C(N)=O)c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16N2O4S/c1-13(5-6-20(18,19)8-13)15-12(17)10-4-2-3-9(7-10)11(14)16/h2-4,7H,5-6,8H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | HCXDYXLETFPELD-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |