C16H22N2O6S3 — CID 166181280
2-N,4-N-bis(3-methyl-1,1-dioxothiolan-3-yl)thiophene-2,4-dicarboxamide (PubChem CID 166181280) has the molecular formula C16H22N2O6S3 and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-N,4-N-bis(3-methyl-1,1-dioxothiolan-3-yl)thiophene-2,4-dicarboxamide.
| Compound Name | 2-N,4-N-bis(3-methyl-1,1-dioxothiolan-3-yl)thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 166181280 |
| Molecular Formula | C16H22N2O6S3 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 2-N,4-N-bis(3-methyl-1,1-dioxothiolan-3-yl)thiophene-2,4-dicarboxamide |
| SMILES | CC1(NC(=O)c2csc(C(=O)NC3(C)CCS(=O)(=O)C3)c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22N2O6S3/c1-15(3-5-26(21,22)9-15)17-13(19)11-7-12(25-8-11)14(20)18-16(2)4-6-27(23,24)10-16/h7-8H,3-6,9-10H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | PJXNRVJAKQTVTK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |