C13H15NO4S2 — CID 79696155
5-(3-hydroxyprop-1-ynyl)-N-(3-methyl-1,1-dioxothiolan-3-yl)thiophene-3-carboxamide (PubChem CID 79696155) has the molecular formula C13H15NO4S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-N-(3-methyl-1,1-dioxothiolan-3-yl)thiophene-3-carboxamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-N-(3-methyl-1,1-dioxothiolan-3-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79696155 |
| Molecular Formula | C13H15NO4S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-N-(3-methyl-1,1-dioxothiolan-3-yl)thiophene-3-carboxamide |
| SMILES | CC1(NC(=O)c2csc(C#CCO)c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15NO4S2/c1-13(4-6-20(17,18)9-13)14-12(16)10-7-11(19-8-10)3-2-5-15/h7-8,15H,4-6,9H2,1H3,(H,14,16) |
| InChIKey | SSKWTTDEYBVCJA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|