C10H8F3NO2S — CID 79693657
5-(3-hydroxyprop-1-ynyl)-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide (PubChem CID 79693657) has the molecular formula C10H8F3NO2S and a molecular weight of 263.24 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79693657 |
| Molecular Formula | C10H8F3NO2S |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1csc(C#CCO)c1 |
| InChI | InChI=1S/C10H8F3NO2S/c11-10(12,13)6-14-9(16)7-4-8(17-5-7)2-1-3-15/h4-5,15H,3,6H2,(H,14,16) |
| InChIKey | AXWMQFPNXLDUAX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|