C14H8F3NO2S — CID 79692399
5-(3-hydroxyprop-1-ynyl)-N-(2,3,4-trifluorophenyl)thiophene-3-carboxamide (PubChem CID 79692399) has the molecular formula C14H8F3NO2S and a molecular weight of 311.28 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-N-(2,3,4-trifluorophenyl)thiophene-3-carboxamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-N-(2,3,4-trifluorophenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79692399 |
| Molecular Formula | C14H8F3NO2S |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-N-(2,3,4-trifluorophenyl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1csc(C#CCO)c1 |
| InChI | InChI=1S/C14H8F3NO2S/c15-10-3-4-11(13(17)12(10)16)18-14(20)8-6-9(21-7-8)2-1-5-19/h3-4,6-7,19H,5H2,(H,18,20) |
| InChIKey | WMPCFUZJNOQAMT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|