C14H10ClNO2S — CID 79695922
N-(3-chlorophenyl)-5-(3-hydroxyprop-1-ynyl)thiophene-3-carboxamide (PubChem CID 79695922) has the molecular formula C14H10ClNO2S and a molecular weight of 291.76 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-(3-hydroxyprop-1-ynyl)thiophene-3-carboxamide.
| Compound Name | N-(3-chlorophenyl)-5-(3-hydroxyprop-1-ynyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79695922 |
| Molecular Formula | C14H10ClNO2S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | N-(3-chlorophenyl)-5-(3-hydroxyprop-1-ynyl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1csc(C#CCO)c1 |
| InChI | InChI=1S/C14H10ClNO2S/c15-11-3-1-4-12(8-11)16-14(18)10-7-13(19-9-10)5-2-6-17/h1,3-4,7-9,17H,6H2,(H,16,18) |
| InChIKey | BDYXWPKJXPGZOV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|