C16H12ClNO2 — CID 60816686
N-(3-chlorophenyl)-3-(3-hydroxyprop-1-ynyl)benzamide (PubChem CID 60816686) has the molecular formula C16H12ClNO2 and a molecular weight of 285.73 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(3-hydroxyprop-1-ynyl)benzamide.
| Compound Name | N-(3-chlorophenyl)-3-(3-hydroxyprop-1-ynyl)benzamide |
|---|---|
| PubChem CID | 60816686 |
| Molecular Formula | C16H12ClNO2 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-(3-chlorophenyl)-3-(3-hydroxyprop-1-ynyl)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cccc(C#CCO)c1 |
| InChI | InChI=1S/C16H12ClNO2/c17-14-7-2-8-15(11-14)18-16(20)13-6-1-4-12(10-13)5-3-9-19/h1-2,4,6-8,10-11,19H,9H2,(H,18,20) |
| InChIKey | ARZURJUUDHDYTA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|