C15H11NO4S — CID 79692605
N-(1,3-benzodioxol-5-yl)-5-(3-hydroxyprop-1-ynyl)thiophene-3-carboxamide (PubChem CID 79692605) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-(3-hydroxyprop-1-ynyl)thiophene-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-(3-hydroxyprop-1-ynyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79692605 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-(3-hydroxyprop-1-ynyl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1csc(C#CCO)c1 |
| InChI | InChI=1S/C15H11NO4S/c17-5-1-2-12-6-10(8-21-12)15(18)16-11-3-4-13-14(7-11)20-9-19-13/h3-4,6-8,17H,5,9H2,(H,16,18) |
| InChIKey | PIOSAHJZFUNBSC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|