C11H9N3O3S — CID 62787318
2-amino-N-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxamide (PubChem CID 62787318) has the molecular formula C11H9N3O3S and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-amino-N-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62787318 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-amino-N-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxamide |
| SMILES | Nc1nc(C(=O)Nc2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C11H9N3O3S/c12-11-14-7(4-18-11)10(15)13-6-1-2-8-9(3-6)17-5-16-8/h1-4H,5H2,(H2,12,14)(H,13,15) |
| InChIKey | CJOOYGOBZLLFIP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |