C18H15N3O4S — CID 84555006
2-(1,3-benzodioxol-5-ylamino)-N-(2-hydroxy-5-methylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 84555006) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-(2-hydroxy-5-methylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-(2-hydroxy-5-methylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 84555006 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-(2-hydroxy-5-methylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(O)c(NC(=O)c2csc(Nc3ccc4c(c3)OCO4)n2)c1 |
| InChI | InChI=1S/C18H15N3O4S/c1-10-2-4-14(22)12(6-10)20-17(23)13-8-26-18(21-13)19-11-3-5-15-16(7-11)25-9-24-15/h2-8,22H,9H2,1H3,(H,19,21)(H,20,23) |
| InChIKey | JVTMABLQKMHYFL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|