C18H23N3O4S — CID 84556190
2-(1,3-benzodioxol-5-ylamino)-N-(3-butoxypropyl)-1,3-thiazole-4-carboxamide (PubChem CID 84556190) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-(3-butoxypropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-(3-butoxypropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 84556190 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-(3-butoxypropyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCCOCCCNC(=O)c1csc(Nc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C18H23N3O4S/c1-2-3-8-23-9-4-7-19-17(22)14-11-26-18(21-14)20-13-5-6-15-16(10-13)25-12-24-15/h5-6,10-11H,2-4,7-9,12H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | FXFQBMXVLJZYKS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|