C14H14N2O4S — CID 84564759
ethyl 2-[2-(1,3-benzodioxol-5-ylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 84564759) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is ethyl 2-[2-(1,3-benzodioxol-5-ylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(1,3-benzodioxol-5-ylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 84564759 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | ethyl 2-[2-(1,3-benzodioxol-5-ylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(Nc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C14H14N2O4S/c1-2-18-13(17)6-10-7-21-14(16-10)15-9-3-4-11-12(5-9)20-8-19-11/h3-5,7H,2,6,8H2,1H3,(H,15,16) |
| InChIKey | FDHRSTASAAYAHS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |