C14H15N3O3S — CID 107810524
ethyl 2-[2-(3-carbamoylanilino)-1,3-thiazol-4-yl]acetate (PubChem CID 107810524) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is ethyl 2-[2-(3-carbamoylanilino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(3-carbamoylanilino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 107810524 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | ethyl 2-[2-(3-carbamoylanilino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(Nc2cccc(C(N)=O)c2)n1 |
| InChI | InChI=1S/C14H15N3O3S/c1-2-20-12(18)7-11-8-21-14(17-11)16-10-5-3-4-9(6-10)13(15)19/h3-6,8H,2,7H2,1H3,(H2,15,19)(H,16,17) |
| InChIKey | LSYAKTKHTGKUGJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |