C16H20N2O2S — CID 80574423
ethyl 2-[2-(4-propylanilino)-1,3-thiazol-4-yl]acetate (PubChem CID 80574423) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is ethyl 2-[2-(4-propylanilino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(4-propylanilino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 80574423 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethyl 2-[2-(4-propylanilino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCCc1ccc(Nc2nc(CC(=O)OCC)cs2)cc1 |
| InChI | InChI=1S/C16H20N2O2S/c1-3-5-12-6-8-13(9-7-12)17-16-18-14(11-21-16)10-15(19)20-4-2/h6-9,11H,3-5,10H2,1-2H3,(H,17,18) |
| InChIKey | SKNYTBGKHKOFGZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |