C14H13N3O2S2 — CID 107806769
ethyl 2-[2-(1,3-benzothiazol-6-ylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 107806769) has the molecular formula C14H13N3O2S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is ethyl 2-[2-(1,3-benzothiazol-6-ylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(1,3-benzothiazol-6-ylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 107806769 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | ethyl 2-[2-(1,3-benzothiazol-6-ylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(Nc2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C14H13N3O2S2/c1-2-19-13(18)6-10-7-20-14(17-10)16-9-3-4-11-12(5-9)21-8-15-11/h3-5,7-8H,2,6H2,1H3,(H,16,17) |
| InChIKey | WARWIVUSABYUSR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |