C13H11N3O2S2 — CID 107806768
3-[2-(1,3-benzothiazol-6-ylamino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 107806768) has the molecular formula C13H11N3O2S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-[2-(1,3-benzothiazol-6-ylamino)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(1,3-benzothiazol-6-ylamino)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 107806768 |
| Molecular Formula | C13H11N3O2S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 3-[2-(1,3-benzothiazol-6-ylamino)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1csc(Nc2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C13H11N3O2S2/c17-12(18)4-2-9-6-19-13(16-9)15-8-1-3-10-11(5-8)20-7-14-10/h1,3,5-7H,2,4H2,(H,15,16)(H,17,18) |
| InChIKey | BTZAWKSPNAYAAY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |