C13H14N2O2S2 — CID 107647029
3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 107647029) has the molecular formula C13H14N2O2S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 107647029 |
| Molecular Formula | C13H14N2O2S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | CSc1ccccc1Nc1nc(CCC(=O)O)cs1 |
| InChI | InChI=1S/C13H14N2O2S2/c1-18-11-5-3-2-4-10(11)15-13-14-9(8-19-13)6-7-12(16)17/h2-5,8H,6-7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | VJOIIOGSRIWAEU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |