3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid

C13H14N2O2S2 — CID 107647029

IUPAC3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid
SMILESCSc1ccccc1Nc1nc(CCC(=O)O)cs1
InChIInChI=1S/C13H14N2O2S2/c1-18-11-5-3-2-4-10(11)15-13-14-9(8-19-13)6-7-12(16)17/h2-5,8H,6-7H2,1H3,(H,14,15)(H,16,17)
InChIKeyVJOIIOGSRIWAEU-UHFFFAOYSA-N
MW294.40 g/mol
LogP3.63
Rot. Bonds6

About 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid

3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 107647029) has the molecular formula C13H14N2O2S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid
PubChem CID107647029
Molecular FormulaC13H14N2O2S2
Molecular Weight294.40 g/mol
Exact Mass294.05
IUPAC Name3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid
SMILESCSc1ccccc1Nc1nc(CCC(=O)O)cs1
InChIInChI=1S/C13H14N2O2S2/c1-18-11-5-3-2-4-10(11)15-13-14-9(8-19-13)6-7-12(16)17/h2-5,8H,6-7H2,1H3,(H,14,15)(H,16,17)
InChIKeyVJOIIOGSRIWAEU-UHFFFAOYSA-N
XLogP3.63
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.40
LogP ≤ 53.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid?
The IUPAC name of 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid (CID 107647029) is 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid?
The canonical SMILES for 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid is CSc1ccccc1Nc1nc(CCC(=O)O)cs1.
What is the InChIKey of 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid?
The InChIKey is VJOIIOGSRIWAEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2S2/c1-18-11-5-3-2-4-10(11)15-13-14-9(8-19-13)6-7-12(16)17/h2-5,8H,6-7H2,1H3,(H,14,15)(H,16,17).
What are the key properties of 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid?
3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid has a molecular weight of 294.40 g/mol, XLogP of 3.63, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-methylsulfanylanilino)-1,3-thiazol-4-yl]propanoic acid is sourced from PubChem (CID 107647029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).