C12H9Cl2FN2O2S — CID 103488405
3-[2-(2,6-dichloro-4-fluoroanilino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103488405) has the molecular formula C12H9Cl2FN2O2S and a molecular weight of 335.19 g/mol. Its IUPAC name is 3-[2-(2,6-dichloro-4-fluoroanilino)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(2,6-dichloro-4-fluoroanilino)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103488405 |
| Molecular Formula | C12H9Cl2FN2O2S |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | 3-[2-(2,6-dichloro-4-fluoroanilino)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1csc(Nc2c(Cl)cc(F)cc2Cl)n1 |
| InChI | InChI=1S/C12H9Cl2FN2O2S/c13-8-3-6(15)4-9(14)11(8)17-12-16-7(5-20-12)1-2-10(18)19/h3-5H,1-2H2,(H,16,17)(H,18,19) |
| InChIKey | JLLRHLXGNWFUTI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |