C13H11F3N2O2S — CID 58795533
3-[2-[4-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]propanoic acid (PubChem CID 58795533) has the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. Its IUPAC name is 3-[2-[4-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-[4-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 58795533 |
| Molecular Formula | C13H11F3N2O2S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 3-[2-[4-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1csc(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C13H11F3N2O2S/c14-13(15,16)8-1-3-9(4-2-8)17-12-18-10(7-21-12)5-6-11(19)20/h1-4,7H,5-6H2,(H,17,18)(H,19,20) |
| InChIKey | NVGRJKVWFZYIKC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |