C9H14N4O3S — CID 103488416
3-[2-[2-(carbamoylamino)ethylamino]-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103488416) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3-[2-[2-(carbamoylamino)ethylamino]-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-[2-(carbamoylamino)ethylamino]-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103488416 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-[2-[2-(carbamoylamino)ethylamino]-1,3-thiazol-4-yl]propanoic acid |
| SMILES | NC(=O)NCCNc1nc(CCC(=O)O)cs1 |
| InChI | InChI=1S/C9H14N4O3S/c10-8(16)11-3-4-12-9-13-6(5-17-9)1-2-7(14)15/h5H,1-4H2,(H,12,13)(H,14,15)(H3,10,11,16) |
| InChIKey | MELQQEJEPWHOFR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|