C12H19N3O3S — CID 114162847
methyl 3-[2-[(5-amino-5-oxopentyl)amino]-1,3-thiazol-4-yl]propanoate (PubChem CID 114162847) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is methyl 3-[2-[(5-amino-5-oxopentyl)amino]-1,3-thiazol-4-yl]propanoate.
| Compound Name | methyl 3-[2-[(5-amino-5-oxopentyl)amino]-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 114162847 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | methyl 3-[2-[(5-amino-5-oxopentyl)amino]-1,3-thiazol-4-yl]propanoate |
| SMILES | COC(=O)CCc1csc(NCCCCC(N)=O)n1 |
| InChI | InChI=1S/C12H19N3O3S/c1-18-11(17)6-5-9-8-19-12(15-9)14-7-3-2-4-10(13)16/h8H,2-7H2,1H3,(H2,13,16)(H,14,15) |
| InChIKey | UXJSBLOFHZXQHP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|