C11H19N3O4S2 — CID 106331960
methyl 3-[2-[3-(methanesulfonamido)propylamino]-1,3-thiazol-4-yl]propanoate (PubChem CID 106331960) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is methyl 3-[2-[3-(methanesulfonamido)propylamino]-1,3-thiazol-4-yl]propanoate.
| Compound Name | methyl 3-[2-[3-(methanesulfonamido)propylamino]-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 106331960 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | methyl 3-[2-[3-(methanesulfonamido)propylamino]-1,3-thiazol-4-yl]propanoate |
| SMILES | COC(=O)CCc1csc(NCCCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C11H19N3O4S2/c1-18-10(15)5-4-9-8-19-11(14-9)12-6-3-7-13-20(2,16)17/h8,13H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | JZPNZLXWBWTVMX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|