C8H13N3O4S2 — CID 115423580
methyl 2-[2-(methanesulfonamido)ethylamino]-1,3-thiazole-4-carboxylate (PubChem CID 115423580) has the molecular formula C8H13N3O4S2 and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl 2-[2-(methanesulfonamido)ethylamino]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[2-(methanesulfonamido)ethylamino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 115423580 |
| Molecular Formula | C8H13N3O4S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | methyl 2-[2-(methanesulfonamido)ethylamino]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(NCCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C8H13N3O4S2/c1-15-7(12)6-5-16-8(11-6)9-3-4-10-17(2,13)14/h5,10H,3-4H2,1-2H3,(H,9,11) |
| InChIKey | SQIOXWSFHBXWGI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|