C11H18N2O4S — CID 114098751
methyl 2-[3-(2-methoxyethoxy)propylamino]-1,3-thiazole-4-carboxylate (PubChem CID 114098751) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is methyl 2-[3-(2-methoxyethoxy)propylamino]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[3-(2-methoxyethoxy)propylamino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 114098751 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | methyl 2-[3-(2-methoxyethoxy)propylamino]-1,3-thiazole-4-carboxylate |
| SMILES | COCCOCCCNc1nc(C(=O)OC)cs1 |
| InChI | InChI=1S/C11H18N2O4S/c1-15-6-7-17-5-3-4-12-11-13-9(8-18-11)10(14)16-2/h8H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | SSMJWPHAFVTKPM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|