C10H16N2O4S — CID 155592482
methyl 2-(4,5-dihydroxypentylamino)-1,3-thiazole-4-carboxylate (PubChem CID 155592482) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is methyl 2-(4,5-dihydroxypentylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(4,5-dihydroxypentylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 155592482 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | methyl 2-(4,5-dihydroxypentylamino)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(NCCCC(O)CO)n1 |
| InChI | InChI=1S/C10H16N2O4S/c1-16-9(15)8-6-17-10(12-8)11-4-2-3-7(14)5-13/h6-7,13-14H,2-5H2,1H3,(H,11,12) |
| InChIKey | FMSMUBNHEKADBI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|