About methyl 2-(2-methoxyethyl)-1,3-thiazole-4-carboxylate
methyl 2-(2-methoxyethyl)-1,3-thiazole-4-carboxylate (PubChem CID 115422665) has the molecular formula C8H11NO3S
and a molecular weight of 201.25 g/mol. Its IUPAC name is methyl 2-(2-methoxyethyl)-1,3-thiazole-4-carboxylate.
Analyze methyl 2-(2-methoxyethyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-methoxyethyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 2-(2-methoxyethyl)-1,3-thiazole-4-carboxylate (CID 115422665) is methyl 2-(2-methoxyethyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 2-(2-methoxyethyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 2-(2-methoxyethyl)-1,3-thiazole-4-carboxylate is COCCc1nc(C(=O)OC)cs1.
What is the InChIKey of methyl 2-(2-methoxyethyl)-1,3-thiazole-4-carboxylate?
The InChIKey is GCGYIDZEROOMKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3S/c1-11-4-3-7-9-6(5-13-7)8(10)12-2/h5H,3-4H2,1-2H3.
What are the key properties of methyl 2-(2-methoxyethyl)-1,3-thiazole-4-carboxylate?
methyl 2-(2-methoxyethyl)-1,3-thiazole-4-carboxylate has a molecular weight of 201.25 g/mol, XLogP of 1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-methoxyethyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 115422665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).