C6H6ClNO2S — CID 25067319
methyl 2-(chloromethyl)-1,3-thiazole-4-carboxylate (PubChem CID 25067319) has the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. Its IUPAC name is methyl 2-(chloromethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(chloromethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 25067319 |
| Molecular Formula | C6H6ClNO2S |
| Molecular Weight | 191.64 g/mol |
| Exact Mass | 190.98 |
| IUPAC Name | methyl 2-(chloromethyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(CCl)n1 |
| InChI | InChI=1S/C6H6ClNO2S/c1-10-6(9)4-3-11-5(2-7)8-4/h3H,2H2,1H3 |
| InChIKey | SRDRWIMXEFYHIK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.64 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|