C11H19NO2S2Si — CID 165481196
methyl 2-(2-trimethylsilylethylsulfanylmethyl)-1,3-thiazole-4-carboxylate (PubChem CID 165481196) has the molecular formula C11H19NO2S2Si and a molecular weight of 289.50 g/mol. Its IUPAC name is methyl 2-(2-trimethylsilylethylsulfanylmethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(2-trimethylsilylethylsulfanylmethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 165481196 |
| Molecular Formula | C11H19NO2S2Si |
| Molecular Weight | 289.50 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | methyl 2-(2-trimethylsilylethylsulfanylmethyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(CSCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C11H19NO2S2Si/c1-14-11(13)9-7-16-10(12-9)8-15-5-6-17(2,3)4/h7H,5-6,8H2,1-4H3 |
| InChIKey | HRMQHPGYCGGIGX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|