C6H7NO2S — CID 14812829
methyl 2-methyl-1,3-thiazole-4-carboxylate (PubChem CID 14812829) has the molecular formula C6H7NO2S and a molecular weight of 157.19 g/mol. Its IUPAC name is methyl 2-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 14812829 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | methyl 2-methyl-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(C)n1 |
| InChI | InChI=1S/C6H7NO2S/c1-4-7-5(3-10-4)6(8)9-2/h3H,1-2H3 |
| InChIKey | FZERNAIKPVSQHU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |