C10H13NO2S — CID 142313714
ethane;methyl 2-prop-1-ynyl-1,3-thiazole-4-carboxylate (PubChem CID 142313714) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is ethane;methyl 2-prop-1-ynyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethane;methyl 2-prop-1-ynyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 142313714 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | ethane;methyl 2-prop-1-ynyl-1,3-thiazole-4-carboxylate |
| SMILES | CC.CC#Cc1nc(C(=O)OC)cs1 |
| InChI | InChI=1S/C8H7NO2S.C2H6/c1-3-4-7-9-6(5-12-7)8(10)11-2;1-2/h5H,1-2H3;1-2H3 |
| InChIKey | RHMSLQXKGLWROI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|