C8H7NOS — CID 142313557
1-(2-prop-1-ynyl-1,3-thiazol-4-yl)ethanone (PubChem CID 142313557) has the molecular formula C8H7NOS and a molecular weight of 165.22 g/mol. Its IUPAC name is 1-(2-prop-1-ynyl-1,3-thiazol-4-yl)ethanone.
| Compound Name | 1-(2-prop-1-ynyl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 142313557 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 1-(2-prop-1-ynyl-1,3-thiazol-4-yl)ethanone |
| SMILES | CC#Cc1nc(C(C)=O)cs1 |
| InChI | InChI=1S/C8H7NOS/c1-3-4-8-9-7(5-11-8)6(2)10/h5H,1-2H3 |
| InChIKey | BJTCDZSGSROAMP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|