C12H19NOS — CID 71026114
1-(2-heptan-4-yl-1,3-thiazol-4-yl)ethanone (PubChem CID 71026114) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 1-(2-heptan-4-yl-1,3-thiazol-4-yl)ethanone.
| Compound Name | 1-(2-heptan-4-yl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 71026114 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 1-(2-heptan-4-yl-1,3-thiazol-4-yl)ethanone |
| SMILES | CCCC(CCC)c1nc(C(C)=O)cs1 |
| InChI | InChI=1S/C12H19NOS/c1-4-6-10(7-5-2)12-13-11(8-15-12)9(3)14/h8,10H,4-7H2,1-3H3 |
| InChIKey | JGHZVLQXNQRLRS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |