C11H17NOS — CID 118396881
1-(2-pentan-3-yl-1,3-thiazol-4-yl)propan-2-one (PubChem CID 118396881) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is 1-(2-pentan-3-yl-1,3-thiazol-4-yl)propan-2-one.
| Compound Name | 1-(2-pentan-3-yl-1,3-thiazol-4-yl)propan-2-one |
|---|---|
| PubChem CID | 118396881 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 1-(2-pentan-3-yl-1,3-thiazol-4-yl)propan-2-one |
| SMILES | CCC(CC)c1nc(CC(C)=O)cs1 |
| InChI | InChI=1S/C11H17NOS/c1-4-9(5-2)11-12-10(7-14-11)6-8(3)13/h7,9H,4-6H2,1-3H3 |
| InChIKey | NLAVQUAADMYIIM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |