About 1-(2-methylsulfanyl-1,3-thiazol-4-yl)propan-2-one
1-(2-methylsulfanyl-1,3-thiazol-4-yl)propan-2-one (PubChem CID 83876844) has the molecular formula C7H9NOS2
and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-(2-methylsulfanyl-1,3-thiazol-4-yl)propan-2-one.
Analyze 1-(2-methylsulfanyl-1,3-thiazol-4-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylsulfanyl-1,3-thiazol-4-yl)propan-2-one?
The IUPAC name of 1-(2-methylsulfanyl-1,3-thiazol-4-yl)propan-2-one (CID 83876844) is 1-(2-methylsulfanyl-1,3-thiazol-4-yl)propan-2-one.
What is the SMILES notation for 1-(2-methylsulfanyl-1,3-thiazol-4-yl)propan-2-one?
The canonical SMILES for 1-(2-methylsulfanyl-1,3-thiazol-4-yl)propan-2-one is CSc1nc(CC(C)=O)cs1.
What is the InChIKey of 1-(2-methylsulfanyl-1,3-thiazol-4-yl)propan-2-one?
The InChIKey is LZWZWCVFPKJDOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NOS2/c1-5(9)3-6-4-11-7(8-6)10-2/h4H,3H2,1-2H3.
What are the key properties of 1-(2-methylsulfanyl-1,3-thiazol-4-yl)propan-2-one?
1-(2-methylsulfanyl-1,3-thiazol-4-yl)propan-2-one has a molecular weight of 187.29 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylsulfanyl-1,3-thiazol-4-yl)propan-2-one is sourced from PubChem (CID 83876844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).