C12H9BrFNOS — CID 116890267
1-[2-(5-bromo-2-fluorophenyl)-1,3-thiazol-4-yl]propan-2-one (PubChem CID 116890267) has the molecular formula C12H9BrFNOS and a molecular weight of 314.18 g/mol. Its IUPAC name is 1-[2-(5-bromo-2-fluorophenyl)-1,3-thiazol-4-yl]propan-2-one.
| Compound Name | 1-[2-(5-bromo-2-fluorophenyl)-1,3-thiazol-4-yl]propan-2-one |
|---|---|
| PubChem CID | 116890267 |
| Molecular Formula | C12H9BrFNOS |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | 1-[2-(5-bromo-2-fluorophenyl)-1,3-thiazol-4-yl]propan-2-one |
| SMILES | CC(=O)Cc1csc(-c2cc(Br)ccc2F)n1 |
| InChI | InChI=1S/C12H9BrFNOS/c1-7(16)4-9-6-17-12(15-9)10-5-8(13)2-3-11(10)14/h2-3,5-6H,4H2,1H3 |
| InChIKey | GZZQBHBDDHPZRP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |