C11H8BrClFNS — CID 116889010
2-(5-bromo-2-fluorophenyl)-4-(2-chloroethyl)-1,3-thiazole (PubChem CID 116889010) has the molecular formula C11H8BrClFNS and a molecular weight of 320.61 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-4-(2-chloroethyl)-1,3-thiazole.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-4-(2-chloroethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116889010 |
| Molecular Formula | C11H8BrClFNS |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 318.92 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-4-(2-chloroethyl)-1,3-thiazole |
| SMILES | Fc1ccc(Br)cc1-c1nc(CCCl)cs1 |
| InChI | InChI=1S/C11H8BrClFNS/c12-7-1-2-10(14)9(5-7)11-15-8(3-4-13)6-16-11/h1-2,5-6H,3-4H2 |
| InChIKey | DSCRISWRRNQGKY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|