C11H10BrFN2OS — CID 116890698
2-amino-1-[2-(5-bromo-2-fluorophenyl)-1,3-thiazol-4-yl]ethanol (PubChem CID 116890698) has the molecular formula C11H10BrFN2OS and a molecular weight of 317.18 g/mol. Its IUPAC name is 2-amino-1-[2-(5-bromo-2-fluorophenyl)-1,3-thiazol-4-yl]ethanol.
| Compound Name | 2-amino-1-[2-(5-bromo-2-fluorophenyl)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 116890698 |
| Molecular Formula | C11H10BrFN2OS |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 2-amino-1-[2-(5-bromo-2-fluorophenyl)-1,3-thiazol-4-yl]ethanol |
| SMILES | NCC(O)c1csc(-c2cc(Br)ccc2F)n1 |
| InChI | InChI=1S/C11H10BrFN2OS/c12-6-1-2-8(13)7(3-6)11-15-9(5-17-11)10(16)4-14/h1-3,5,10,16H,4,14H2 |
| InChIKey | XNUCYVTZWZONAL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |