C13H14BrFN2S — CID 116967305
2-[4-(5-bromo-2-fluorophenyl)-1,3-thiazol-2-yl]butan-1-amine (PubChem CID 116967305) has the molecular formula C13H14BrFN2S and a molecular weight of 329.24 g/mol. Its IUPAC name is 2-[4-(5-bromo-2-fluorophenyl)-1,3-thiazol-2-yl]butan-1-amine.
| Compound Name | 2-[4-(5-bromo-2-fluorophenyl)-1,3-thiazol-2-yl]butan-1-amine |
|---|---|
| PubChem CID | 116967305 |
| Molecular Formula | C13H14BrFN2S |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 2-[4-(5-bromo-2-fluorophenyl)-1,3-thiazol-2-yl]butan-1-amine |
| SMILES | CCC(CN)c1nc(-c2cc(Br)ccc2F)cs1 |
| InChI | InChI=1S/C13H14BrFN2S/c1-2-8(6-16)13-17-12(7-18-13)10-5-9(14)3-4-11(10)15/h3-5,7-8H,2,6,16H2,1H3 |
| InChIKey | YIDBRWHRJNSZKV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |