C9H7BrFN3S — CID 82973465
[4-(5-bromo-2-fluorophenyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 82973465) has the molecular formula C9H7BrFN3S and a molecular weight of 288.15 g/mol. Its IUPAC name is [4-(5-bromo-2-fluorophenyl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [4-(5-bromo-2-fluorophenyl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 82973465 |
| Molecular Formula | C9H7BrFN3S |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 286.95 |
| IUPAC Name | [4-(5-bromo-2-fluorophenyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1nc(-c2cc(Br)ccc2F)cs1 |
| InChI | InChI=1S/C9H7BrFN3S/c10-5-1-2-7(11)6(3-5)8-4-15-9(13-8)14-12/h1-4H,12H2,(H,13,14) |
| InChIKey | HRBLEIPSRISLHS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|