C9H9BrClN3S — CID 90481496
[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazine;hydrochloride (PubChem CID 90481496) has the molecular formula C9H9BrClN3S and a molecular weight of 306.62 g/mol. Its IUPAC name is [4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazine;hydrochloride.
| Compound Name | [4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazine;hydrochloride |
|---|---|
| PubChem CID | 90481496 |
| Molecular Formula | C9H9BrClN3S |
| Molecular Weight | 306.62 g/mol |
| Exact Mass | 304.94 |
| IUPAC Name | [4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazine;hydrochloride |
| SMILES | Cl.NNc1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C9H8BrN3S.ClH/c10-7-3-1-6(2-4-7)8-5-14-9(12-8)13-11;/h1-5H,11H2,(H,12,13);1H |
| InChIKey | KFVCKPLQEUVUIM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.62 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|