C13H18N4S — CID 7148397
N,N-diethyl-4-(2-hydrazinyl-1,3-thiazol-4-yl)aniline (PubChem CID 7148397) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is N,N-diethyl-4-(2-hydrazinyl-1,3-thiazol-4-yl)aniline.
| Compound Name | N,N-diethyl-4-(2-hydrazinyl-1,3-thiazol-4-yl)aniline |
|---|---|
| PubChem CID | 7148397 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N,N-diethyl-4-(2-hydrazinyl-1,3-thiazol-4-yl)aniline |
| SMILES | CCN(CC)c1ccc(-c2csc(NN)n2)cc1 |
| InChI | InChI=1S/C13H18N4S/c1-3-17(4-2)11-7-5-10(6-8-11)12-9-18-13(15-12)16-14/h5-9H,3-4,14H2,1-2H3,(H,15,16) |
| InChIKey | UUCCABRPSCHDQQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|