C23H29N5O2S — CID 87381012
1-[4-[4-(diethylamino)phenyl]-1,3-thiazol-2-yl]-2-[(2,6-dimethoxyphenyl)methyl]guanidine (PubChem CID 87381012) has the molecular formula C23H29N5O2S and a molecular weight of 439.59 g/mol. Its IUPAC name is 1-[4-[4-(diethylamino)phenyl]-1,3-thiazol-2-yl]-2-[(2,6-dimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-[4-[4-(diethylamino)phenyl]-1,3-thiazol-2-yl]-2-[(2,6-dimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 87381012 |
| Molecular Formula | C23H29N5O2S |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 1-[4-[4-(diethylamino)phenyl]-1,3-thiazol-2-yl]-2-[(2,6-dimethoxyphenyl)methyl]guanidine |
| SMILES | CCN(CC)c1ccc(-c2csc(N/C(N)=N/Cc3c(OC)cccc3OC)n2)cc1 |
| InChI | InChI=1S/C23H29N5O2S/c1-5-28(6-2)17-12-10-16(11-13-17)19-15-31-23(26-19)27-22(24)25-14-18-20(29-3)8-7-9-21(18)30-4/h7-13,15H,5-6,14H2,1-4H3,(H3,24,25,26,27) |
| InChIKey | VEZPWTZGIZEVIL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|