C20H23BrN4O2S — CID 67386436
2-[(2,6-dimethoxyphenyl)methyl]-1-(5-methyl-4-phenyl-1,3-thiazol-2-yl)guanidine;hydrobromide (PubChem CID 67386436) has the molecular formula C20H23BrN4O2S and a molecular weight of 463.40 g/mol. Its IUPAC name is 2-[(2,6-dimethoxyphenyl)methyl]-1-(5-methyl-4-phenyl-1,3-thiazol-2-yl)guanidine;hydrobromide.
| Compound Name | 2-[(2,6-dimethoxyphenyl)methyl]-1-(5-methyl-4-phenyl-1,3-thiazol-2-yl)guanidine;hydrobromide |
|---|---|
| PubChem CID | 67386436 |
| Molecular Formula | C20H23BrN4O2S |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2-[(2,6-dimethoxyphenyl)methyl]-1-(5-methyl-4-phenyl-1,3-thiazol-2-yl)guanidine;hydrobromide |
| SMILES | Br.COc1cccc(OC)c1C/N=C(\N)Nc1nc(-c2ccccc2)c(C)s1 |
| InChI | InChI=1S/C20H22N4O2S.BrH/c1-13-18(14-8-5-4-6-9-14)23-20(27-13)24-19(21)22-12-15-16(25-2)10-7-11-17(15)26-3;/h4-11H,12H2,1-3H3,(H3,21,22,23,24);1H |
| InChIKey | SWZLQOBHTAUWEJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|