C17H19BrN4O2S2 — CID 67386826
2-[(2,6-dimethoxyphenyl)methyl]-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)guanidine;hydrobromide (PubChem CID 67386826) has the molecular formula C17H19BrN4O2S2 and a molecular weight of 455.40 g/mol. Its IUPAC name is 2-[(2,6-dimethoxyphenyl)methyl]-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)guanidine;hydrobromide.
| Compound Name | 2-[(2,6-dimethoxyphenyl)methyl]-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)guanidine;hydrobromide |
|---|---|
| PubChem CID | 67386826 |
| Molecular Formula | C17H19BrN4O2S2 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 2-[(2,6-dimethoxyphenyl)methyl]-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)guanidine;hydrobromide |
| SMILES | Br.COc1cccc(OC)c1C/N=C(\N)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C17H18N4O2S2.BrH/c1-22-13-5-3-6-14(23-2)11(13)9-19-16(18)21-17-20-12(10-25-17)15-7-4-8-24-15;/h3-8,10H,9H2,1-2H3,(H3,18,19,20,21);1H |
| InChIKey | LKMJZAZDUWMTCP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|