C17H17ClN4O2S2 — CID 87380484
1-[4-(4-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2-[(2,6-dimethoxyphenyl)methyl]guanidine (PubChem CID 87380484) has the molecular formula C17H17ClN4O2S2 and a molecular weight of 408.94 g/mol. Its IUPAC name is 1-[4-(4-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2-[(2,6-dimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-[4-(4-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2-[(2,6-dimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 87380484 |
| Molecular Formula | C17H17ClN4O2S2 |
| Molecular Weight | 408.94 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 1-[4-(4-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2-[(2,6-dimethoxyphenyl)methyl]guanidine |
| SMILES | COc1cccc(OC)c1C/N=C(\N)Nc1nc(-c2cc(Cl)cs2)cs1 |
| InChI | InChI=1S/C17H17ClN4O2S2/c1-23-13-4-3-5-14(24-2)11(13)7-20-16(19)22-17-21-12(9-26-17)15-6-10(18)8-25-15/h3-6,8-9H,7H2,1-2H3,(H3,19,20,21,22) |
| InChIKey | OPKBMYDALFHZST-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.94 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|