C17H23N5O2S — CID 67386277
2-[(2,6-dimethoxyphenyl)methyl]-1-(4-pyrrolidin-2-yl-1,3-thiazol-2-yl)guanidine (PubChem CID 67386277) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-[(2,6-dimethoxyphenyl)methyl]-1-(4-pyrrolidin-2-yl-1,3-thiazol-2-yl)guanidine.
| Compound Name | 2-[(2,6-dimethoxyphenyl)methyl]-1-(4-pyrrolidin-2-yl-1,3-thiazol-2-yl)guanidine |
|---|---|
| PubChem CID | 67386277 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-[(2,6-dimethoxyphenyl)methyl]-1-(4-pyrrolidin-2-yl-1,3-thiazol-2-yl)guanidine |
| SMILES | COc1cccc(OC)c1C/N=C(\N)Nc1nc(C2CCCN2)cs1 |
| InChI | InChI=1S/C17H23N5O2S/c1-23-14-6-3-7-15(24-2)11(14)9-20-16(18)22-17-21-13(10-25-17)12-5-4-8-19-12/h3,6-7,10,12,19H,4-5,8-9H2,1-2H3,(H3,18,20,21,22) |
| InChIKey | CFGDUOICUIEIOI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|